CAS 1374574-72-7 is the registry number for 8-Bromochroman-4-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
8-bromo-3,4-dihydro-2H-chromene-4-carboxylic acid (CAS 1374574-72-7) is a chemical compound with the molecular formula C10H9BrO3 and a molecular weight of 257.08 g/mol. IUPAC name: 8-bromo-3,4-dihydro-2H-chromene-4-carboxylic acid. InChIKey: KGTJIAVKBYTUQV-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO3 |
|---|---|
| Molecular weight | 257.08 g/mol |
| IUPAC name | 8-bromo-3,4-dihydro-2H-chromene-4-carboxylic acid |
| InChIKey | KGTJIAVKBYTUQV-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1C(=O)O)C=CC=C2Br |
Computed by PubChem (NCBI)