CAS 1374651-47-4 appears in our catalog under these names: 2-Amino-2-(2,4-difluorophenyl)acetic acid hydrochloride, 95%, 2–Amino–2–(2,4–difluorophenyl)acetic acid hydrochloride, 2-AMINO-2-(2,4-DIFLUOROPHENYL)ACETIC ACID HCL, 95%. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 1g, 5g, 25g, 250mg.
2-amino-2-(2,4-difluorophenyl)acetic acid;hydrochloride (CAS 1374651-47-4) is a chemical compound with the molecular formula C8H8ClF2NO2 and a molecular weight of 223.60 g/mol. IUPAC name: 2-amino-2-(2,4-difluorophenyl)acetic acid;hydrochloride. InChIKey: WIXGQKSSYMPCBH-UHFFFAOYSA-N.
| Molecular formula | C8H8ClF2NO2 |
|---|---|
| Molecular weight | 223.60 g/mol |
| IUPAC name | 2-amino-2-(2,4-difluorophenyl)acetic acid;hydrochloride |
| InChIKey | WIXGQKSSYMPCBH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C(C(=O)O)N.Cl |
Computed by PubChem (NCBI)