CAS 1803605-25-5 appears in our catalog under these names: 4-(Aminomethyl)-2,6-difluorobenzoic acid hydrochloride, 95%, 4-(Aminomethyl)-2,6-difluorobenzoic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-(aminomethyl)-2,6-difluorobenzoic acid;hydrochloride (CAS 1803605-25-5) is a chemical compound with the molecular formula C8H8ClF2NO2 and a molecular weight of 223.60 g/mol. IUPAC name: 4-(aminomethyl)-2,6-difluorobenzoic acid;hydrochloride. InChIKey: JMYWZRRXWHDFSR-UHFFFAOYSA-N.
| Molecular formula | C8H8ClF2NO2 |
|---|---|
| Molecular weight | 223.60 g/mol |
| IUPAC name | 4-(aminomethyl)-2,6-difluorobenzoic acid;hydrochloride |
| InChIKey | JMYWZRRXWHDFSR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)C(=O)O)F)CN.Cl |
Computed by PubChem (NCBI)