Products 2734906-53-5
CAS 2734906-53-5 is the registry number for (2,2-Difluorobenzo[d][1,3]dioxol-4-yl)methanamine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2,2-difluoro-1,3-benzodioxol-4-yl)methanamine;hydrochloride (CAS 2734906-53-5) is a chemical compound with the molecular formula C8H8ClF2NO2 and a molecular weight of 223.60 g/mol. IUPAC name: (2,2-difluoro-1,3-benzodioxol-4-yl)methanamine;hydrochloride. InChIKey: ZMDJMJDQLHIGAL-UHFFFAOYSA-N.
| Molecular formula | C8H8ClF2NO2 |
|---|---|
| Molecular weight | 223.60 g/mol |
| IUPAC name | (2,2-difluoro-1,3-benzodioxol-4-yl)methanamine;hydrochloride |
| InChIKey | ZMDJMJDQLHIGAL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)OC(O2)(F)F)CN.Cl |
Computed by PubChem (NCBI)