CAS 2248325-43-9 is the registry number for 4-(Aminomethyl)-3,5-difluorobenzoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-(aminomethyl)-3,5-difluorobenzoic acid;hydrochloride (CAS 2248325-43-9) is a chemical compound with the molecular formula C8H8ClF2NO2 and a molecular weight of 223.60 g/mol. IUPAC name: 4-(aminomethyl)-3,5-difluorobenzoic acid;hydrochloride. InChIKey: UZUYAIOVHBLJMT-UHFFFAOYSA-N.
| Molecular formula | C8H8ClF2NO2 |
|---|---|
| Molecular weight | 223.60 g/mol |
| IUPAC name | 4-(aminomethyl)-3,5-difluorobenzoic acid;hydrochloride |
| InChIKey | UZUYAIOVHBLJMT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)CN)F)C(=O)O.Cl |
Computed by PubChem (NCBI)