CAS 1374669-66-5 appears in our catalog under these names: (R)-N-Boc-3-t-butyl-beta-alanine, 95%, (R)-3-((tert-Butoxycarbonyl)amino)-4,4-dimethylpentanoic acid, (R)-3-((tert-Butoxycarbonyl)amino)-4,4-dimethylpentanoic acid, 95%, 95%, (3r)-3-{[(tert-butoxy)carbonyl]amino}-4,4-dimethylpentanoic acid, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 1g, 5g, 100mg, 0,5g.
(3R)-4,4-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 1374669-66-5) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: (3R)-4,4-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: GJOMHEYOQWPVEZ-MRVPVSSYSA-N.
| Molecular formula | C12H23NO4 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | (3R)-4,4-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | GJOMHEYOQWPVEZ-MRVPVSSYSA-N |
| SMILES | CC(C)(C)[C@@H](CC(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)