CAS 856417-59-9 appears in our catalog under these names: 3-N-Boc-amino-4,4-dimethyl pentanoic acid, 95%, 3–N–BOC–AMINO–4,4–DIMETHYL PENTANOIC ACID, Boc-beta-Tle-OH. Offered by: Combi-blocks, GLPBio, Iris Biotech. Available pack sizes: 5g, 250mg, 1g.
4,4-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 856417-59-9) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: 4,4-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: GJOMHEYOQWPVEZ-UHFFFAOYSA-N.
| Molecular formula | C12H23NO4 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | 4,4-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | GJOMHEYOQWPVEZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(CC(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)