Products 137476-72-3
CAS 137476-72-3 is the registry number for Gnetifolin A. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 50mg, 25mg, Get quote.
5-(5-hydroxy-3-methoxy-1-benzofuran-2-yl)-2-methoxybenzene-1,3-diol (CAS 137476-72-3) is a chemical compound with the molecular formula C16H14O6 and a molecular weight of 302.28 g/mol. IUPAC name: 5-(5-hydroxy-3-methoxy-1-benzofuran-2-yl)-2-methoxybenzene-1,3-diol. InChIKey: CAEHKJSYOQDIJH-UHFFFAOYSA-N.
| Molecular formula | C16H14O6 |
|---|---|
| Molecular weight | 302.28 g/mol |
| IUPAC name | 5-(5-hydroxy-3-methoxy-1-benzofuran-2-yl)-2-methoxybenzene-1,3-diol |
| InChIKey | CAEHKJSYOQDIJH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1O)C2=C(C3=C(O2)C=CC(=C3)O)OC)O |
Computed by PubChem (NCBI)