Products 1374765-83-9
CAS 1374765-83-9 is the registry number for 2-Amino-2-(5-bromo-2-fluorophenyl)propanoic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-2-(5-bromo-2-fluorophenyl)propanoic acid;hydrochloride (CAS 1374765-83-9) is a chemical compound with the molecular formula C9H10BrClFNO2 and a molecular weight of 298.53 g/mol. IUPAC name: 2-amino-2-(5-bromo-2-fluorophenyl)propanoic acid;hydrochloride. InChIKey: VVAZAXPMYYQIAC-UHFFFAOYSA-N.
| Molecular formula | C9H10BrClFNO2 |
|---|---|
| Molecular weight | 298.53 g/mol |
| IUPAC name | 2-amino-2-(5-bromo-2-fluorophenyl)propanoic acid;hydrochloride |
| InChIKey | VVAZAXPMYYQIAC-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=CC(=C1)Br)F)(C(=O)O)N.Cl |
Computed by PubChem (NCBI)