CAS 2061980-53-6 appears in our catalog under these names: 3-Amino-3-(4-bromo-3-fluorophenyl)propanoic acid hydrochloride, 95%, 3–Amino–3–(4–bromo–3–fluorophenyl)propanoic acid hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg, 1g, 250mg.
3-amino-3-(4-bromo-3-fluorophenyl)propanoic acid;hydrochloride (CAS 2061980-53-6) is a chemical compound with the molecular formula C9H10BrClFNO2 and a molecular weight of 298.53 g/mol. IUPAC name: 3-amino-3-(4-bromo-3-fluorophenyl)propanoic acid;hydrochloride. InChIKey: RWJRLCWDUABOIF-UHFFFAOYSA-N.
| Molecular formula | C9H10BrClFNO2 |
|---|---|
| Molecular weight | 298.53 g/mol |
| IUPAC name | 3-amino-3-(4-bromo-3-fluorophenyl)propanoic acid;hydrochloride |
| InChIKey | RWJRLCWDUABOIF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(CC(=O)O)N)F)Br.Cl |
Computed by PubChem (NCBI)