Products 2703513-80-6

CAS 2703513-80-6 appears in our catalog under these names: 3-Amino-3-(2-bromo-5-fluorophenyl)propanoic acid hydrochloride, 95%, 95%, 3-Amino-3-(2-bromo-5-fluorophenyl)propanoic acid hydrochloride, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

3-amino-3-(2-bromo-5-fluorophenyl)propanoic acid;hydrochloride (CAS 2703513-80-6) is a chemical compound with the molecular formula C9H10BrClFNO2 and a molecular weight of 298.53 g/mol. IUPAC name: 3-amino-3-(2-bromo-5-fluorophenyl)propanoic acid;hydrochloride. InChIKey: IZQPWCCIMNMCQU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10BrClFNO2
Molecular weight298.53 g/mol
IUPAC name3-amino-3-(2-bromo-5-fluorophenyl)propanoic acid;hydrochloride
InChIKeyIZQPWCCIMNMCQU-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1F)C(CC(=O)O)N)Br.Cl

Computed by PubChem (NCBI)