CAS 1391381-36-4 appears in our catalog under these names: Methyl (2r)-2-amino-2-(2-bromo-4-fluorophenyl)acetate hydrochloride, 95%, Methyl (R)-2-amino-2-(2-bromo-4-fluorophenyl)acetate hcl, 95%, 95%, METHYL (R)-2-AMINO-2-(2-BROMO-4-FLUOROPHENYL)ACETATE HCL, 95%, Methyl (R)-2-amino-2-(2-bromo-4-fluorophenyl)acetate hydrochloride, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 50mg, 100mg.
Methyl (2R)-2-amino-2-(2-bromo-4-fluorophenyl)acetate;hydrochloride (CAS 1391381-36-4) is a chemical compound with the molecular formula C9H10BrClFNO2 and a molecular weight of 298.53 g/mol. IUPAC name: methyl (2R)-2-amino-2-(2-bromo-4-fluorophenyl)acetate;hydrochloride. InChIKey: IMZCGWDUKHEOGA-DDWIOCJRSA-N.
| Molecular formula | C9H10BrClFNO2 |
|---|---|
| Molecular weight | 298.53 g/mol |
| IUPAC name | methyl (2R)-2-amino-2-(2-bromo-4-fluorophenyl)acetate;hydrochloride |
| InChIKey | IMZCGWDUKHEOGA-DDWIOCJRSA-N |
| SMILES | COC(=O)[C@@H](C1=C(C=C(C=C1)F)Br)N.Cl |
Computed by PubChem (NCBI)