Products 93387-94-1

CAS 93387-94-1 is the registry number for 2-Amino-4-((tert-butoxycarbonyl)amino)butanoic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 93387-94-1) is a chemical compound with the molecular formula C9H18N2O4 and a molecular weight of 218.25 g/mol. IUPAC name: 2-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: ICJFZQLAIOCZNG-UHFFFAOYSA-N.

Identity
Molecular formulaC9H18N2O4
Molecular weight218.25 g/mol
IUPAC name2-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid
InChIKeyICJFZQLAIOCZNG-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCCC(C(=O)O)N

Computed by PubChem (NCBI)