Products 1375065-87-4
CAS 1375065-87-4 is the registry number for 5-Bromo-2-(trifluoromethyl)benzene-1-sulfonyl chloride, 95+%. Offered by: Ambeed. Available pack sizes: 250mg, 100mg, 5g.
5-bromo-2-(trifluoromethyl)benzenesulfonyl chloride (CAS 1375065-87-4) is a chemical compound with the molecular formula C7H3BrClF3O2S and a molecular weight of 323.52 g/mol. IUPAC name: 5-bromo-2-(trifluoromethyl)benzenesulfonyl chloride. InChIKey: YYXBLOYYPXCFJH-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClF3O2S |
|---|---|
| Molecular weight | 323.52 g/mol |
| IUPAC name | 5-bromo-2-(trifluoromethyl)benzenesulfonyl chloride |
| InChIKey | YYXBLOYYPXCFJH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)S(=O)(=O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)