CAS 54403-98-4 appears in our catalog under these names: 2–Bromo–4–(trifluoromethyl)benzenesulfonyl chloride, 2-Bromo-4-(trifluoromethyl)benzenesulfonylchloride, 97%, 2-Bromo-4-(trifluoromethyl)benzenesulfonyl chloride, 97%. Offered by: GLPBio, Fluorochem, Combi-blocks. Available pack sizes: 1g, 5g, 25g.
2-bromo-4-(trifluoromethyl)benzenesulfonyl chloride (CAS 54403-98-4) is a chemical compound with the molecular formula C7H3BrClF3O2S and a molecular weight of 323.52 g/mol. IUPAC name: 2-bromo-4-(trifluoromethyl)benzenesulfonyl chloride. InChIKey: WWEGTYZLWBOTQW-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClF3O2S |
|---|---|
| Molecular weight | 323.52 g/mol |
| IUPAC name | 2-bromo-4-(trifluoromethyl)benzenesulfonyl chloride |
| InChIKey | WWEGTYZLWBOTQW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)