CAS 351003-47-9 appears in our catalog under these names: 4-Bromo-3-(trifluoromethyl)benzenesulfonylchloride, 97%, 4-Bromo-3-(trifluoromethyl)benzene-1-sulfonyl chloride, 98%. Offered by: Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 25g, 100g, 10g.
4-bromo-3-(trifluoromethyl)benzenesulfonyl chloride (CAS 351003-47-9) is a chemical compound with the molecular formula C7H3BrClF3O2S and a molecular weight of 323.52 g/mol. IUPAC name: 4-bromo-3-(trifluoromethyl)benzenesulfonyl chloride. InChIKey: QCFIMBHKZZLZAE-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClF3O2S |
|---|---|
| Molecular weight | 323.52 g/mol |
| IUPAC name | 4-bromo-3-(trifluoromethyl)benzenesulfonyl chloride |
| InChIKey | QCFIMBHKZZLZAE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)Cl)C(F)(F)F)Br |
Computed by PubChem (NCBI)