Products 55695-21-1

CAS 55695-21-1 is the registry number for 2-Bromo-3-(trifluoromethyl)benzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

2-bromo-3-(trifluoromethyl)benzenesulfonyl chloride (CAS 55695-21-1) is a chemical compound with the molecular formula C7H3BrClF3O2S and a molecular weight of 323.52 g/mol. IUPAC name: 2-bromo-3-(trifluoromethyl)benzenesulfonyl chloride. InChIKey: AWLHRPVOQDBLGH-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3BrClF3O2S
Molecular weight323.52 g/mol
IUPAC name2-bromo-3-(trifluoromethyl)benzenesulfonyl chloride
InChIKeyAWLHRPVOQDBLGH-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)S(=O)(=O)Cl)Br)C(F)(F)F

Computed by PubChem (NCBI)