Products 1375068-88-4
CAS 1375068-88-4 is the registry number for 4-Bromo-1,3,3-trimethylindol-2-one, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
4-bromo-1,3,3-trimethylindol-2-one (CAS 1375068-88-4) is a chemical compound with the molecular formula C11H12BrNO and a molecular weight of 254.12 g/mol. IUPAC name: 4-bromo-1,3,3-trimethylindol-2-one. InChIKey: CYNFKZPKEJQNMT-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO |
|---|---|
| Molecular weight | 254.12 g/mol |
| IUPAC name | 4-bromo-1,3,3-trimethylindol-2-one |
| InChIKey | CYNFKZPKEJQNMT-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC=C2Br)N(C1=O)C)C |
Computed by PubChem (NCBI)