CAS 1375097-86-1 is the registry number for (3-(1,3-Thiazol-4-yl)phenyl)methanol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
[3-(1,3-thiazol-4-yl)phenyl]methanol (CAS 1375097-86-1) is a chemical compound with the molecular formula C10H9NOS and a molecular weight of 191.25 g/mol. IUPAC name: [3-(1,3-thiazol-4-yl)phenyl]methanol. InChIKey: JDJNBSZLICXTHX-UHFFFAOYSA-N.
| Molecular formula | C10H9NOS |
|---|---|
| Molecular weight | 191.25 g/mol |
| IUPAC name | [3-(1,3-thiazol-4-yl)phenyl]methanol |
| InChIKey | JDJNBSZLICXTHX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CSC=N2)CO |
Computed by PubChem (NCBI)