Products 137515-05-0
CAS 137515-05-0 is the registry number for RG-14467. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(2,5-dihydroxyphenyl)methylamino]benzamide (CAS 137515-05-0) is a chemical compound with the molecular formula C14H14N2O3 and a molecular weight of 258.27 g/mol. IUPAC name: 4-[(2,5-dihydroxyphenyl)methylamino]benzamide. InChIKey: CHXLDPYIXVXZTF-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O3 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | 4-[(2,5-dihydroxyphenyl)methylamino]benzamide |
| InChIKey | CHXLDPYIXVXZTF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)N)NCC2=C(C=CC(=C2)O)O |
Computed by PubChem (NCBI)