CAS 1375473-29-2 appears in our catalog under these names: 5-Benzyl-1,3-benzoxazol-2-amine, 5-Benzyl-1,3-benzoxazol-2-amine, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
5-benzyl-1,3-benzoxazol-2-amine (CAS 1375473-29-2) is a chemical compound with the molecular formula C14H12N2O and a molecular weight of 224.26 g/mol. IUPAC name: 5-benzyl-1,3-benzoxazol-2-amine. InChIKey: GZWPJMUINIVRSN-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | 5-benzyl-1,3-benzoxazol-2-amine |
| InChIKey | GZWPJMUINIVRSN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC3=C(C=C2)OC(=N3)N |
Computed by PubChem (NCBI)