CAS 1375473-98-5 appears in our catalog under these names: 1-Methyl-2-phenyl-1H,6H,7H-pyrrolo(2,3-c)pyridin-7-one, 95%, 1-Methyl-2-phenyl-1H,6H,7H-pyrrolo(2,3-c)pyridin-7-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-methyl-2-phenyl-6H-pyrrolo[2,3-c]pyridin-7-one (CAS 1375473-98-5) is a chemical compound with the molecular formula C14H12N2O and a molecular weight of 224.26 g/mol. IUPAC name: 1-methyl-2-phenyl-6H-pyrrolo[2,3-c]pyridin-7-one. InChIKey: HSKUAZNCNMLDCC-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | 1-methyl-2-phenyl-6H-pyrrolo[2,3-c]pyridin-7-one |
| InChIKey | HSKUAZNCNMLDCC-UHFFFAOYSA-N |
| SMILES | CN1C(=CC2=C1C(=O)NC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)