Products 137577-90-3
CAS 137577-90-3 is the registry number for 2-Amino-1-(2,5-dimethylphenyl)ethan-1-one hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-amino-1-(2,5-dimethylphenyl)ethanone;hydrochloride (CAS 137577-90-3) is a chemical compound with the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. IUPAC name: 2-amino-1-(2,5-dimethylphenyl)ethanone;hydrochloride. InChIKey: MUUFEBYUDXLJQD-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO |
|---|---|
| Molecular weight | 199.68 g/mol |
| IUPAC name | 2-amino-1-(2,5-dimethylphenyl)ethanone;hydrochloride |
| InChIKey | MUUFEBYUDXLJQD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)C(=O)CN.Cl |
Computed by PubChem (NCBI)