Products 1375996-02-3
CAS 1375996-02-3 is the registry number for 4-Chloro-6-((4-methoxyphenyl)thio)pyrimidin-2-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-6-(4-methoxyphenyl)sulfanylpyrimidin-2-amine (CAS 1375996-02-3) is a chemical compound with the molecular formula C11H10ClN3OS and a molecular weight of 267.74 g/mol. IUPAC name: 4-chloro-6-(4-methoxyphenyl)sulfanylpyrimidin-2-amine. InChIKey: JUKJWAGNJCKFIC-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN3OS |
|---|---|
| Molecular weight | 267.74 g/mol |
| IUPAC name | 4-chloro-6-(4-methoxyphenyl)sulfanylpyrimidin-2-amine |
| InChIKey | JUKJWAGNJCKFIC-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)SC2=CC(=NC(=N2)N)Cl |
Computed by PubChem (NCBI)