CAS 749920-74-9 is the registry number for 3-Amino-5-(4-chlorophenyl)thiophene-2-carbohydrazide, 95%. Offered by: AmBeed. Available pack sizes: 10g.
3-amino-5-(4-chlorophenyl)thiophene-2-carbohydrazide (CAS 749920-74-9) is a chemical compound with the molecular formula C11H10ClN3OS and a molecular weight of 267.74 g/mol. IUPAC name: 3-amino-5-(4-chlorophenyl)thiophene-2-carbohydrazide. InChIKey: MPDFAMPLLOPPNC-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN3OS |
|---|---|
| Molecular weight | 267.74 g/mol |
| IUPAC name | 3-amino-5-(4-chlorophenyl)thiophene-2-carbohydrazide |
| InChIKey | MPDFAMPLLOPPNC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C(S2)C(=O)NN)N)Cl |
Computed by PubChem (NCBI)