Products 875160-23-9
CAS 875160-23-9 appears in our catalog under these names: N-Benzyl-5-(chloromethyl)-1,3,4-thiadiazole-2-carboxamide, 95%, N-Benzyl-5-(chloromethyl)-1,3,4-thiadiazole-2-carboxamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
N-benzyl-5-(chloromethyl)-1,3,4-thiadiazole-2-carboxamide (CAS 875160-23-9) is a chemical compound with the molecular formula C11H10ClN3OS and a molecular weight of 267.74 g/mol. IUPAC name: N-benzyl-5-(chloromethyl)-1,3,4-thiadiazole-2-carboxamide. InChIKey: MMJOGMFEHYNOHX-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN3OS |
|---|---|
| Molecular weight | 267.74 g/mol |
| IUPAC name | N-benzyl-5-(chloromethyl)-1,3,4-thiadiazole-2-carboxamide |
| InChIKey | MMJOGMFEHYNOHX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC(=O)C2=NN=C(S2)CCl |
Computed by PubChem (NCBI)