CAS 2318-79-8 is the registry number for 5-Hydroxy Thiabendazole Methyl Ether Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
4-(6-methoxy-1H-benzimidazol-2-yl)-1,3-thiazole;hydrochloride (CAS 2318-79-8) is a chemical compound with the molecular formula C11H10ClN3OS and a molecular weight of 267.74 g/mol. IUPAC name: 4-(6-methoxy-1H-benzimidazol-2-yl)-1,3-thiazole;hydrochloride. InChIKey: RGJPOJVGBVRASI-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN3OS |
|---|---|
| Molecular weight | 267.74 g/mol |
| IUPAC name | 4-(6-methoxy-1H-benzimidazol-2-yl)-1,3-thiazole;hydrochloride |
| InChIKey | RGJPOJVGBVRASI-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)N=C(N2)C3=CSC=N3.Cl |
Computed by PubChem (NCBI)