Products 2318-79-8

CAS 2318-79-8 is the registry number for 5-Hydroxy Thiabendazole Methyl Ether Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 2,5mg, 25mg.

Structural formula: {0} (CAS {1})

4-(6-methoxy-1H-benzimidazol-2-yl)-1,3-thiazole;hydrochloride (CAS 2318-79-8) is a chemical compound with the molecular formula C11H10ClN3OS and a molecular weight of 267.74 g/mol. IUPAC name: 4-(6-methoxy-1H-benzimidazol-2-yl)-1,3-thiazole;hydrochloride. InChIKey: RGJPOJVGBVRASI-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10ClN3OS
Molecular weight267.74 g/mol
IUPAC name4-(6-methoxy-1H-benzimidazol-2-yl)-1,3-thiazole;hydrochloride
InChIKeyRGJPOJVGBVRASI-UHFFFAOYSA-N
SMILESCOC1=CC2=C(C=C1)N=C(N2)C3=CSC=N3.Cl

Computed by PubChem (NCBI)