Products 1376142-56-1
CAS 1376142-56-1 is the registry number for Oseltamivir Impurity 129. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,4R,5R)-3-acetamido-4-amino-5-pentan-3-yloxycyclohexene-1-carboxylic acid (CAS 1376142-56-1) is a chemical compound with the molecular formula C14H24N2O4 and a molecular weight of 284.35 g/mol. IUPAC name: (3S,4R,5R)-3-acetamido-4-amino-5-pentan-3-yloxycyclohexene-1-carboxylic acid. InChIKey: MRPNQTHCORKFGZ-YNEHKIRRSA-N.
| Molecular formula | C14H24N2O4 |
|---|---|
| Molecular weight | 284.35 g/mol |
| IUPAC name | (3S,4R,5R)-3-acetamido-4-amino-5-pentan-3-yloxycyclohexene-1-carboxylic acid |
| InChIKey | MRPNQTHCORKFGZ-YNEHKIRRSA-N |
| SMILES | CCC(CC)O[C@@H]1CC(=C[C@@H]([C@H]1N)NC(=O)C)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Oseltamivir Impurity N7