CAS 1376217-90-1 appears in our catalog under these names: 4-(2,4-Difluoro-5-methylphenyl)-1,3-thiazol-2-amine, 95%, 4-(2,4-Difluoro-5-methylphenyl)-1,3-thiazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
4-(2,4-difluoro-5-methylphenyl)-1,3-thiazol-2-amine (CAS 1376217-90-1) is a chemical compound with the molecular formula C10H8F2N2S and a molecular weight of 226.25 g/mol. IUPAC name: 4-(2,4-difluoro-5-methylphenyl)-1,3-thiazol-2-amine. InChIKey: GVFNSJRXKXITSL-UHFFFAOYSA-N.
| Molecular formula | C10H8F2N2S |
|---|---|
| Molecular weight | 226.25 g/mol |
| IUPAC name | 4-(2,4-difluoro-5-methylphenyl)-1,3-thiazol-2-amine |
| InChIKey | GVFNSJRXKXITSL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1F)F)C2=CSC(=N2)N |
Computed by PubChem (NCBI)