CAS 1566067-94-4 appears in our catalog under these names: 4-((2,6-Difluorophenyl)methyl)-1,3-thiazol-2-amine, 4-((2,6-Difluorophenyl)methyl)-1,3-thiazol-2-amine, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
4-[(2,6-difluorophenyl)methyl]-1,3-thiazol-2-amine (CAS 1566067-94-4) is a chemical compound with the molecular formula C10H8F2N2S and a molecular weight of 226.25 g/mol. IUPAC name: 4-[(2,6-difluorophenyl)methyl]-1,3-thiazol-2-amine. InChIKey: JAIQUGILWUGSLX-UHFFFAOYSA-N.
| Molecular formula | C10H8F2N2S |
|---|---|
| Molecular weight | 226.25 g/mol |
| IUPAC name | 4-[(2,6-difluorophenyl)methyl]-1,3-thiazol-2-amine |
| InChIKey | JAIQUGILWUGSLX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)CC2=CSC(=N2)N)F |
Computed by PubChem (NCBI)