CAS 1539215-49-0 is the registry number for 5-(2,6-Difluorophenyl)-4-methyl-1,3-thiazol-2-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(2,6-difluorophenyl)-4-methyl-1,3-thiazol-2-amine (CAS 1539215-49-0) is a chemical compound with the molecular formula C10H8F2N2S and a molecular weight of 226.25 g/mol. IUPAC name: 5-(2,6-difluorophenyl)-4-methyl-1,3-thiazol-2-amine. InChIKey: IJCSJFPUFIUFMJ-UHFFFAOYSA-N.
| Molecular formula | C10H8F2N2S |
|---|---|
| Molecular weight | 226.25 g/mol |
| IUPAC name | 5-(2,6-difluorophenyl)-4-methyl-1,3-thiazol-2-amine |
| InChIKey | IJCSJFPUFIUFMJ-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)N)C2=C(C=CC=C2F)F |
Computed by PubChem (NCBI)