CAS 95333-81-6 is the registry number for SKF-102698. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[(3,5-difluorophenyl)methyl]-1H-imidazole-2-thione (CAS 95333-81-6) is a chemical compound with the molecular formula C10H8F2N2S and a molecular weight of 226.25 g/mol. IUPAC name: 3-[(3,5-difluorophenyl)methyl]-1H-imidazole-2-thione. InChIKey: WPMVQUHUCQAOBU-UHFFFAOYSA-N.
| Molecular formula | C10H8F2N2S |
|---|---|
| Molecular weight | 226.25 g/mol |
| IUPAC name | 3-[(3,5-difluorophenyl)methyl]-1H-imidazole-2-thione |
| InChIKey | WPMVQUHUCQAOBU-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=S)N1)CC2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)