CAS 1376321-39-9 is the registry number for 4-Chloro-3,3-Dimethyl-2,3-dihydro-1H-indole Hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-chloro-3,3-dimethyl-1,2-dihydroindole;hydrochloride (CAS 1376321-39-9) is a chemical compound with the molecular formula C10H13Cl2N and a molecular weight of 218.12 g/mol. IUPAC name: 4-chloro-3,3-dimethyl-1,2-dihydroindole;hydrochloride. InChIKey: ZBUXZZKEXRLBHD-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2N |
|---|---|
| Molecular weight | 218.12 g/mol |
| IUPAC name | 4-chloro-3,3-dimethyl-1,2-dihydroindole;hydrochloride |
| InChIKey | ZBUXZZKEXRLBHD-UHFFFAOYSA-N |
| SMILES | CC1(CNC2=C1C(=CC=C2)Cl)C.Cl |
Computed by PubChem (NCBI)