CAS 137660-67-4 is the registry number for 3-(4-fluorobenzyl)thiazolidine-2,4-dione, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione (CAS 137660-67-4) is a chemical compound with the molecular formula C10H8FNO2S and a molecular weight of 225.24 g/mol. IUPAC name: 3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione. InChIKey: GTAZAXSMXJLHEP-UHFFFAOYSA-N.
| Molecular formula | C10H8FNO2S |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | 3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| InChIKey | GTAZAXSMXJLHEP-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C(=O)S1)CC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)