CAS 2090172-47-5 appears in our catalog under these names: Methyl 3-amino-7-fluorobenzo[b]thiophene-2-carboxylate, 98%, 98%, Methyl 3-amino-7-fluorobenzo[b]thiophene-2-carboxylate. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Methyl 3-amino-7-fluoro-1-benzothiophene-2-carboxylate (CAS 2090172-47-5) is a chemical compound with the molecular formula C10H8FNO2S and a molecular weight of 225.24 g/mol. IUPAC name: methyl 3-amino-7-fluoro-1-benzothiophene-2-carboxylate. InChIKey: YQFPPKKFFOMFDT-UHFFFAOYSA-N.
| Molecular formula | C10H8FNO2S |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | methyl 3-amino-7-fluoro-1-benzothiophene-2-carboxylate |
| InChIKey | YQFPPKKFFOMFDT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=C(S1)C(=CC=C2)F)N |
Computed by PubChem (NCBI)