CAS 2375924-16-4 is the registry number for rel-3-(((1R,2R)-2-Fluorocyclopropyl)sulfonyl)benzonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(1R,2R)-2-fluorocyclopropyl]sulfonylbenzonitrile (CAS 2375924-16-4) is a chemical compound with the molecular formula C10H8FNO2S and a molecular weight of 225.24 g/mol. IUPAC name: 3-[(1R,2R)-2-fluorocyclopropyl]sulfonylbenzonitrile. InChIKey: JUDGGMXGCPAAMV-NXEZZACHSA-N.
| Molecular formula | C10H8FNO2S |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | 3-[(1R,2R)-2-fluorocyclopropyl]sulfonylbenzonitrile |
| InChIKey | JUDGGMXGCPAAMV-NXEZZACHSA-N |
| SMILES | C1[C@H]([C@@H]1S(=O)(=O)C2=CC=CC(=C2)C#N)F |
Computed by PubChem (NCBI)