CAS 1803592-04-2 is the registry number for 4-(1H-Pyrrol-1-yl)benzene-1-sulfonyl fluoride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-pyrrol-1-ylbenzenesulfonyl fluoride (CAS 1803592-04-2) is a chemical compound with the molecular formula C10H8FNO2S and a molecular weight of 225.24 g/mol. IUPAC name: 4-pyrrol-1-ylbenzenesulfonyl fluoride. InChIKey: WVHMNUTWELGLOG-UHFFFAOYSA-N.
| Molecular formula | C10H8FNO2S |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | 4-pyrrol-1-ylbenzenesulfonyl fluoride |
| InChIKey | WVHMNUTWELGLOG-UHFFFAOYSA-N |
| SMILES | C1=CN(C=C1)C2=CC=C(C=C2)S(=O)(=O)F |
Computed by PubChem (NCBI)