Products 1803592-04-2

CAS 1803592-04-2 is the registry number for 4-(1H-Pyrrol-1-yl)benzene-1-sulfonyl fluoride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

4-pyrrol-1-ylbenzenesulfonyl fluoride (CAS 1803592-04-2) is a chemical compound with the molecular formula C10H8FNO2S and a molecular weight of 225.24 g/mol. IUPAC name: 4-pyrrol-1-ylbenzenesulfonyl fluoride. InChIKey: WVHMNUTWELGLOG-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8FNO2S
Molecular weight225.24 g/mol
IUPAC name4-pyrrol-1-ylbenzenesulfonyl fluoride
InChIKeyWVHMNUTWELGLOG-UHFFFAOYSA-N
SMILESC1=CN(C=C1)C2=CC=C(C=C2)S(=O)(=O)F

Computed by PubChem (NCBI)