Products 1378078-52-4
CAS 1378078-52-4 is the registry number for 1-Isothiocyanato-2-(2,2,2-trifluoroethoxy)benzene. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-isothiocyanato-2-(2,2,2-trifluoroethoxy)benzene (CAS 1378078-52-4) is a chemical compound with the molecular formula C9H6F3NOS and a molecular weight of 233.21 g/mol. IUPAC name: 1-isothiocyanato-2-(2,2,2-trifluoroethoxy)benzene. InChIKey: FUDONOBFWDFDCR-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NOS |
|---|---|
| Molecular weight | 233.21 g/mol |
| IUPAC name | 1-isothiocyanato-2-(2,2,2-trifluoroethoxy)benzene |
| InChIKey | FUDONOBFWDFDCR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N=C=S)OCC(F)(F)F |
Computed by PubChem (NCBI)