CAS 716-82-5 appears in our catalog under these names: 2,3-Dihydro-6-(trifluoromethyl)benzo[1,4]-thiazin-3-one, 95%, 6-(Trifluoromethyl)-2H-benzo(b)(1,4)thiazin-3(4H)-one, 97%, 6–(Trifluoromethyl)–2H–benzo(b)(1,4)thiazin–3(4H)–one. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 10g, 5g, 100mg.
6-(trifluoromethyl)-4H-1,4-benzothiazin-3-one (CAS 716-82-5) is a chemical compound with the molecular formula C9H6F3NOS and a molecular weight of 233.21 g/mol. IUPAC name: 6-(trifluoromethyl)-4H-1,4-benzothiazin-3-one. InChIKey: CDCYQWJTDZXFCS-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NOS |
|---|---|
| Molecular weight | 233.21 g/mol |
| IUPAC name | 6-(trifluoromethyl)-4H-1,4-benzothiazin-3-one |
| InChIKey | CDCYQWJTDZXFCS-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(S1)C=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)