Products 1540617-68-2
CAS 1540617-68-2 is the registry number for (6-(Trifluoromethyl)-1,3-benzothiazol-2-yl)methanol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
[6-(trifluoromethyl)-1,3-benzothiazol-2-yl]methanol (CAS 1540617-68-2) is a chemical compound with the molecular formula C9H6F3NOS and a molecular weight of 233.21 g/mol. IUPAC name: [6-(trifluoromethyl)-1,3-benzothiazol-2-yl]methanol. InChIKey: LZJPLKUVZZBKQF-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NOS |
|---|---|
| Molecular weight | 233.21 g/mol |
| IUPAC name | [6-(trifluoromethyl)-1,3-benzothiazol-2-yl]methanol |
| InChIKey | LZJPLKUVZZBKQF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)SC(=N2)CO |
Computed by PubChem (NCBI)