CAS 885527-21-9 is the registry number for (5-(Trifluoromethyl)-1,3-benzothiazol-2-yl)methanol, 95%. Offered by: AmBeed. Available pack sizes: 5g.
[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methanol (CAS 885527-21-9) is a chemical compound with the molecular formula C9H6F3NOS and a molecular weight of 233.21 g/mol. IUPAC name: [5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methanol. InChIKey: ZOSBOTQZFNDFLE-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NOS |
|---|---|
| Molecular weight | 233.21 g/mol |
| IUPAC name | [5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methanol |
| InChIKey | ZOSBOTQZFNDFLE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)N=C(S2)CO |
Computed by PubChem (NCBI)