Products 137809-97-3
CAS 137809-97-3 appears in our catalog under these names: 2(5H)-Furanone, 2,3-Di(3',4'-methylenedioxybenzyl)-2-buten-4-olide. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 50mg, 25mg, Get quote.
3,4-bis(1,3-benzodioxol-5-ylmethyl)-2H-furan-5-one (CAS 137809-97-3) is a chemical compound with the molecular formula C20H16O6 and a molecular weight of 352.3 g/mol. IUPAC name: 3,4-bis(1,3-benzodioxol-5-ylmethyl)-2H-furan-5-one. InChIKey: DQUXXEYAJDQQTP-UHFFFAOYSA-N.
| Molecular formula | C20H16O6 |
|---|---|
| Molecular weight | 352.3 g/mol |
| IUPAC name | 3,4-bis(1,3-benzodioxol-5-ylmethyl)-2H-furan-5-one |
| InChIKey | DQUXXEYAJDQQTP-UHFFFAOYSA-N |
| SMILES | C1C(=C(C(=O)O1)CC2=CC3=C(C=C2)OCO3)CC4=CC5=C(C=C4)OCO5 |
Computed by PubChem (NCBI)