Products 221150-19-2
CAS 221150-19-2 appears in our catalog under these names: Erysubin B, Erysubin B, Erysubin B, 98.0%. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 50mg, 25mg, 1 mg, 5 mg.
5-hydroxy-2-(hydroxymethyl)-7-(4-hydroxyphenyl)-2-methylpyrano[3,2-g]chromen-6-one (CAS 221150-19-2) is a chemical compound with the molecular formula C20H16O6 and a molecular weight of 352.3 g/mol. IUPAC name: 5-hydroxy-2-(hydroxymethyl)-7-(4-hydroxyphenyl)-2-methylpyrano[3,2-g]chromen-6-one. InChIKey: OVLQTBOVUNAVGU-UHFFFAOYSA-N.
| Molecular formula | C20H16O6 |
|---|---|
| Molecular weight | 352.3 g/mol |
| IUPAC name | 5-hydroxy-2-(hydroxymethyl)-7-(4-hydroxyphenyl)-2-methylpyrano[3,2-g]chromen-6-one |
| InChIKey | OVLQTBOVUNAVGU-UHFFFAOYSA-N |
| SMILES | CC1(C=CC2=C(O1)C=C3C(=C2O)C(=O)C(=CO3)C4=CC=C(C=C4)O)CO |
Computed by PubChem (NCBI)
Synonyms:
Erysubin B, orb1682633