Products 98113-96-3
CAS 98113-96-3 is the registry number for Lupinalbin B. Offered by: Biosynth. Available pack sizes: 0,25mg, 0,5mg, 1mg.
1,3,8-trihydroxy-2-(3-methylbut-2-enyl)-[1]benzofuro[2,3-b]chromen-11-one (CAS 98113-96-3) is a chemical compound with the molecular formula C20H16O6 and a molecular weight of 352.3 g/mol. IUPAC name: 1,3,8-trihydroxy-2-(3-methylbut-2-enyl)-[1]benzofuro[2,3-b]chromen-11-one. InChIKey: NOYRXEKDLRHOOL-UHFFFAOYSA-N.
| Molecular formula | C20H16O6 |
|---|---|
| Molecular weight | 352.3 g/mol |
| IUPAC name | 1,3,8-trihydroxy-2-(3-methylbut-2-enyl)-[1]benzofuro[2,3-b]chromen-11-one |
| InChIKey | NOYRXEKDLRHOOL-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C2=C(C=C1O)OC3=C(C2=O)C4=C(O3)C=C(C=C4)O)O)C |
Computed by PubChem (NCBI)