Products 221150-18-1
CAS 221150-18-1 is the registry number for Erysubin A. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, Get quote.
4-hydroxy-6-(4-hydroxyphenyl)-2-(2-hydroxypropan-2-yl)furo[3,2-g]chromen-5-one (CAS 221150-18-1) is a chemical compound with the molecular formula C20H16O6 and a molecular weight of 352.3 g/mol. IUPAC name: 4-hydroxy-6-(4-hydroxyphenyl)-2-(2-hydroxypropan-2-yl)furo[3,2-g]chromen-5-one. InChIKey: FJWVISOPPWPZGU-UHFFFAOYSA-N.
| Molecular formula | C20H16O6 |
|---|---|
| Molecular weight | 352.3 g/mol |
| IUPAC name | 4-hydroxy-6-(4-hydroxyphenyl)-2-(2-hydroxypropan-2-yl)furo[3,2-g]chromen-5-one |
| InChIKey | FJWVISOPPWPZGU-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC2=C(C3=C(C=C2O1)OC=C(C3=O)C4=CC=C(C=C4)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
Erysubin A, orb1682634