Products 1378700-07-2
CAS 1378700-07-2 is the registry number for 1-(Carbamoylamino)-2,5-dimethyl-1H-pyrrole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(carbamoylamino)-2,5-dimethylpyrrole-3-carboxylic acid (CAS 1378700-07-2) is a chemical compound with the molecular formula C8H11N3O3 and a molecular weight of 197.19 g/mol. IUPAC name: 1-(carbamoylamino)-2,5-dimethylpyrrole-3-carboxylic acid. InChIKey: VIXOTYHJAIKUOY-UHFFFAOYSA-N.
| Molecular formula | C8H11N3O3 |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | 1-(carbamoylamino)-2,5-dimethylpyrrole-3-carboxylic acid |
| InChIKey | VIXOTYHJAIKUOY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1NC(=O)N)C)C(=O)O |
Computed by PubChem (NCBI)