CAS 1378703-27-5 appears in our catalog under these names: 4-Chlorobenzofuran-2-carboxylic acid, 96%, 4-Chlorobenzofuran-2-carboxylic acid, 96%, 96%, 4-CHLORO-1-BENZOFURAN-2-CARBOXYLIC ACID, 96%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 100mg, 250mg.
4-chloro-1-benzofuran-2-carboxylic acid (CAS 1378703-27-5) is a chemical compound with the molecular formula C9H5ClO3 and a molecular weight of 196.58 g/mol. IUPAC name: 4-chloro-1-benzofuran-2-carboxylic acid. InChIKey: JBHHLXUINCBPKZ-UHFFFAOYSA-N.
| Molecular formula | C9H5ClO3 |
|---|---|
| Molecular weight | 196.58 g/mol |
| IUPAC name | 4-chloro-1-benzofuran-2-carboxylic acid |
| InChIKey | JBHHLXUINCBPKZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(O2)C(=O)O)C(=C1)Cl |
Computed by PubChem (NCBI)