CAS 1378831-04-9 appears in our catalog under these names: 2-[(tert-butoxy)carbonyl]cyclopropane-1-carboxylic acid, 95%, 95%, 2-tert-Butoxycarbonylcyclopropanecarboxylic acid, 95%, 2-(tert-Butoxycarbonyl)cyclopropane-1-carboxylic acid, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 100mg, 250mg.
2-[(2-methylpropan-2-yl)oxycarbonyl]cyclopropane-1-carboxylic acid (CAS 1378831-04-9) is a chemical compound with the molecular formula C9H14O4 and a molecular weight of 186.20 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonyl]cyclopropane-1-carboxylic acid. InChIKey: IQIADELBDBDDAW-UHFFFAOYSA-N.
| Molecular formula | C9H14O4 |
|---|---|
| Molecular weight | 186.20 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonyl]cyclopropane-1-carboxylic acid |
| InChIKey | IQIADELBDBDDAW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1CC1C(=O)O |
Computed by PubChem (NCBI)