CAS 1378859-93-8 is the registry number for 5-Amino-2,2-dimethylbenzofuran-3(2H)-one, 98%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
5-amino-2,2-dimethyl-1-benzofuran-3-one (CAS 1378859-93-8) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 5-amino-2,2-dimethyl-1-benzofuran-3-one. InChIKey: ZERBGYBIMSIHDZ-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 5-amino-2,2-dimethyl-1-benzofuran-3-one |
| InChIKey | ZERBGYBIMSIHDZ-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)C2=C(O1)C=CC(=C2)N)C |
Computed by PubChem (NCBI)