CAS 1379153-60-2 is the registry number for 2-(Methylsulfonyl)benzamide. Offered by: TRC. Available pack sizes: 100mg.
2-methylsulfonylbenzamide (CAS 1379153-60-2) is a chemical compound with the molecular formula C8H9NO3S and a molecular weight of 199.23 g/mol. IUPAC name: 2-methylsulfonylbenzamide. InChIKey: CJKJNTJPOYSDQL-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3S |
|---|---|
| Molecular weight | 199.23 g/mol |
| IUPAC name | 2-methylsulfonylbenzamide |
| InChIKey | CJKJNTJPOYSDQL-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=CC=C1C(=O)N |
Computed by PubChem (NCBI)